Deploy espaloma 0.3.2 force field to parametrize your MM system =============================================================== Pretrained espaloma force field could be deployed on arbitrary small molecule systems in a few lines:: # imports import os import torch import espaloma as esp # define or load a molecule of interest via the Open Force Field toolkit from openff.toolkit.topology import Molecule molecule = Molecule.from_smiles("CN1C=NC2=C1C(=O)N(C(=O)N2C)C") # create an Espaloma Graph object to represent the molecule of interest molecule_graph = esp.Graph(molecule) # load pretrained model espaloma_model = esp.get_model("latest") # apply a trained espaloma model to assign parameters espaloma_model(molecule_graph.heterograph) # create an OpenMM System for the specified molecule openmm_system = esp.graphs.deploy.openmm_system_from_graph(molecule_graph) If using espaloma from a local ``.pt`` file, say for example ``espaloma-0.3.2.pt``, then you would need to run the ``eval`` method of the model to get the correct inference/predictions, as follows:: # load local pretrained model espaloma_model = torch.load("espaloma-0.3.2.pt") espaloma_model.eval() The rest of the code should be the same as in the previous example.